C12H16N2O6S — CID 106168362
3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 106168362) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 106168362 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)NCC(O)C(N)=O)c1C |
| InChI | InChI=1S/C12H16N2O6S/c1-6-3-8(12(17)18)4-10(7(6)2)21(19,20)14-5-9(15)11(13)16/h3-4,9,14-15H,5H2,1-2H3,(H2,13,16)(H,17,18) |
| InChIKey | BRIXMFMDLOTEQB-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |