C10H11ClN2O6S — CID 106168195
3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4-chlorobenzoic acid (PubChem CID 106168195) has the molecular formula C10H11ClN2O6S and a molecular weight of 322.73 g/mol. Its IUPAC name is 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4-chlorobenzoic acid.
| Compound Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 106168195 |
| Molecular Formula | C10H11ClN2O6S |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-4-chlorobenzoic acid |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C10H11ClN2O6S/c11-6-2-1-5(10(16)17)3-8(6)20(18,19)13-4-7(14)9(12)15/h1-3,7,13-14H,4H2,(H2,12,15)(H,16,17) |
| InChIKey | VRVYIWJINLVLBF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |