C9H10BrClFN3O4S — CID 106164884
3-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-2-hydroxypropanamide (PubChem CID 106164884) has the molecular formula C9H10BrClFN3O4S and a molecular weight of 390.62 g/mol. Its IUPAC name is 3-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106164884 |
| Molecular Formula | C9H10BrClFN3O4S |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 3-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C9H10BrClFN3O4S/c10-6-3(11)1-5(7(12)8(6)13)20(18,19)15-2-4(16)9(14)17/h1,4,15-16H,2,13H2,(H2,14,17) |
| InChIKey | CKEFWCHUZZZCPZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|