C10H13BrClFN2O4S — CID 103077618
3-amino-4-bromo-5-chloro-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2-fluorobenzenesulfonamide (PubChem CID 103077618) has the molecular formula C10H13BrClFN2O4S and a molecular weight of 391.65 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2-fluorobenzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103077618 |
| Molecular Formula | C10H13BrClFN2O4S |
| Molecular Weight | 391.65 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2-fluorobenzenesulfonamide |
| SMILES | CC(CO)(CO)NS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C10H13BrClFN2O4S/c1-10(3-16,4-17)15-20(18,19)6-2-5(12)7(11)9(14)8(6)13/h2,15-17H,3-4,14H2,1H3 |
| InChIKey | CPALWBWYSDDNQY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.65 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|