C11H14BrClFN3O3S — CID 103077298
2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide (PubChem CID 103077298) has the molecular formula C11H14BrClFN3O3S and a molecular weight of 402.67 g/mol. Its IUPAC name is 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 103077298 |
| Molecular Formula | C11H14BrClFN3O3S |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C11H14BrClFN3O3S/c1-5(2)17-8(18)4-16-21(19,20)7-3-6(13)9(12)11(15)10(7)14/h3,5,16H,4,15H2,1-2H3,(H,17,18) |
| InChIKey | LNRLGTMWRUQNKL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|