C11H15BrFN3O3S — CID 106491434
2-[(2-amino-5-bromo-4-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide (PubChem CID 106491434) has the molecular formula C11H15BrFN3O3S and a molecular weight of 368.23 g/mol. Its IUPAC name is 2-[(2-amino-5-bromo-4-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(2-amino-5-bromo-4-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 106491434 |
| Molecular Formula | C11H15BrFN3O3S |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 2-[(2-amino-5-bromo-4-fluorophenyl)sulfonylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNS(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C11H15BrFN3O3S/c1-6(2)16-11(17)5-15-20(18,19)10-3-7(12)8(13)4-9(10)14/h3-4,6,15H,5,14H2,1-2H3,(H,16,17) |
| InChIKey | XSLSXTZQLFMZBB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|