C9H12BrFN2O4S — CID 106491866
2-amino-5-bromo-N-(1,3-dihydroxypropan-2-yl)-4-fluorobenzenesulfonamide (PubChem CID 106491866) has the molecular formula C9H12BrFN2O4S and a molecular weight of 343.17 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(1,3-dihydroxypropan-2-yl)-4-fluorobenzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-(1,3-dihydroxypropan-2-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106491866 |
| Molecular Formula | C9H12BrFN2O4S |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2-amino-5-bromo-N-(1,3-dihydroxypropan-2-yl)-4-fluorobenzenesulfonamide |
| SMILES | Nc1cc(F)c(Br)cc1S(=O)(=O)NC(CO)CO |
| InChI | InChI=1S/C9H12BrFN2O4S/c10-6-1-9(8(12)2-7(6)11)18(16,17)13-5(3-14)4-15/h1-2,5,13-15H,3-4,12H2 |
| InChIKey | GTRWJUKRJLMEOV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|