C11H16BrFN2O4S — CID 107864446
2-amino-5-bromo-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide (PubChem CID 107864446) has the molecular formula C11H16BrFN2O4S and a molecular weight of 371.23 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 107864446 |
| Molecular Formula | C11H16BrFN2O4S |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide |
| SMILES | CCC(CO)(CO)NS(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C11H16BrFN2O4S/c1-2-11(5-16,6-17)15-20(18,19)10-3-7(12)8(13)4-9(10)14/h3-4,15-17H,2,5-6,14H2,1H3 |
| InChIKey | UKQJTROYZUWKEQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|