C12H18BrFN2O3S — CID 116530284
5-amino-4-bromo-2-fluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzenesulfonamide (PubChem CID 116530284) has the molecular formula C12H18BrFN2O3S and a molecular weight of 369.26 g/mol. Its IUPAC name is 5-amino-4-bromo-2-fluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-fluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 116530284 |
| Molecular Formula | C12H18BrFN2O3S |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 5-amino-4-bromo-2-fluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzenesulfonamide |
| SMILES | CCC(CC)(CO)NS(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C12H18BrFN2O3S/c1-3-12(4-2,7-17)16-20(18,19)11-6-10(15)8(13)5-9(11)14/h5-6,16-17H,3-4,7,15H2,1-2H3 |
| InChIKey | GWICBBWMSPUMGZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|