C9H12BrFN2O4S2 — CID 116529842
5-amino-4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 116529842) has the molecular formula C9H12BrFN2O4S2 and a molecular weight of 375.24 g/mol. Its IUPAC name is 5-amino-4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116529842 |
| Molecular Formula | C9H12BrFN2O4S2 |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | 5-amino-4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C9H12BrFN2O4S2/c1-18(14,15)3-2-13-19(16,17)9-5-8(12)6(10)4-7(9)11/h4-5,13H,2-3,12H2,1H3 |
| InChIKey | FFULOBATMGBBJV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|