C9H11BrFNO4S2 — CID 116528194
4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 116528194) has the molecular formula C9H11BrFNO4S2 and a molecular weight of 360.23 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116528194 |
| Molecular Formula | C9H11BrFNO4S2 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.93 |
| IUPAC Name | 4-bromo-2-fluoro-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C9H11BrFNO4S2/c1-17(13,14)5-4-12-18(15,16)9-3-2-7(10)6-8(9)11/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | SGTRVVCLNIUODP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |