C9H12BrFN2O2S — CID 116527471
N-(3-aminopropyl)-4-bromo-2-fluorobenzenesulfonamide (PubChem CID 116527471) has the molecular formula C9H12BrFN2O2S and a molecular weight of 311.18 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-bromo-2-fluorobenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-4-bromo-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116527471 |
| Molecular Formula | C9H12BrFN2O2S |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | N-(3-aminopropyl)-4-bromo-2-fluorobenzenesulfonamide |
| SMILES | NCCCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C9H12BrFN2O2S/c10-7-2-3-9(8(11)6-7)16(14,15)13-5-1-4-12/h2-3,6,13H,1,4-5,12H2 |
| InChIKey | KJGFDOZNQQFJLD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|