C9H10BrFN2O2S2 — CID 116527556
3-[(4-bromo-2-fluorophenyl)sulfonylamino]propanethioamide (PubChem CID 116527556) has the molecular formula C9H10BrFN2O2S2 and a molecular weight of 341.23 g/mol. Its IUPAC name is 3-[(4-bromo-2-fluorophenyl)sulfonylamino]propanethioamide.
| Compound Name | 3-[(4-bromo-2-fluorophenyl)sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 116527556 |
| Molecular Formula | C9H10BrFN2O2S2 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | 3-[(4-bromo-2-fluorophenyl)sulfonylamino]propanethioamide |
| SMILES | NC(=S)CCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C9H10BrFN2O2S2/c10-6-1-2-8(7(11)5-6)17(14,15)13-4-3-9(12)16/h1-2,5,13H,3-4H2,(H2,12,16) |
| InChIKey | MQVFVCRGINWWDK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|