C8H7BrF3NO2S — CID 116528761
4-bromo-N-(2,2-difluoroethyl)-2-fluorobenzenesulfonamide (PubChem CID 116528761) has the molecular formula C8H7BrF3NO2S and a molecular weight of 318.11 g/mol. Its IUPAC name is 4-bromo-N-(2,2-difluoroethyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(2,2-difluoroethyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116528761 |
| Molecular Formula | C8H7BrF3NO2S |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 4-bromo-N-(2,2-difluoroethyl)-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)F)c1ccc(Br)cc1F |
| InChI | InChI=1S/C8H7BrF3NO2S/c9-5-1-2-7(6(10)3-5)16(14,15)13-4-8(11)12/h1-3,8,13H,4H2 |
| InChIKey | QYVHUAOCVSPIQJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |