C9H11BrFNO2S — CID 116527446
4-bromo-2-fluoro-N-propylbenzenesulfonamide (PubChem CID 116527446) has the molecular formula C9H11BrFNO2S and a molecular weight of 296.16 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-propylbenzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 116527446 |
| Molecular Formula | C9H11BrFNO2S |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 4-bromo-2-fluoro-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C9H11BrFNO2S/c1-2-5-12-15(13,14)9-4-3-7(10)6-8(9)11/h3-4,6,12H,2,5H2,1H3 |
| InChIKey | AGDPWVYGAARQLT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |