C8H8BrClFNO4S2 — CID 116530088
2-[(4-bromo-2-fluorophenyl)sulfonylamino]ethanesulfonyl chloride (PubChem CID 116530088) has the molecular formula C8H8BrClFNO4S2 and a molecular weight of 380.64 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)sulfonylamino]ethanesulfonyl chloride.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)sulfonylamino]ethanesulfonyl chloride |
|---|---|
| PubChem CID | 116530088 |
| Molecular Formula | C8H8BrClFNO4S2 |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 378.88 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)sulfonylamino]ethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C8H8BrClFNO4S2/c9-6-1-2-8(7(11)5-6)18(15,16)12-3-4-17(10,13)14/h1-2,5,12H,3-4H2 |
| InChIKey | GMEZBJPBDAPVHI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |