C8H10BrFN2O2S — CID 116527470
N-(2-aminoethyl)-4-bromo-2-fluorobenzenesulfonamide (PubChem CID 116527470) has the molecular formula C8H10BrFN2O2S and a molecular weight of 297.15 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-bromo-2-fluorobenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-4-bromo-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116527470 |
| Molecular Formula | C8H10BrFN2O2S |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | N-(2-aminoethyl)-4-bromo-2-fluorobenzenesulfonamide |
| SMILES | NCCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C8H10BrFN2O2S/c9-6-1-2-8(7(10)5-6)15(13,14)12-4-3-11/h1-2,5,12H,3-4,11H2 |
| InChIKey | AEFGOAPGAFNZNF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |