C9H10BrF3N2O2S — CID 100648205
N-(2-aminoethyl)-4-bromo-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 100648205) has the molecular formula C9H10BrF3N2O2S and a molecular weight of 347.16 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-bromo-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-4-bromo-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100648205 |
| Molecular Formula | C9H10BrF3N2O2S |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | N-(2-aminoethyl)-4-bromo-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | NCCNS(=O)(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C9H10BrF3N2O2S/c10-6-1-2-8(7(5-6)9(11,12)13)18(16,17)15-4-3-14/h1-2,5,15H,3-4,14H2 |
| InChIKey | XNHOLBOQJMPYRN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |