C11H14BrClFNO2S — CID 116530073
4-bromo-N-(2-chloropentyl)-2-fluorobenzenesulfonamide (PubChem CID 116530073) has the molecular formula C11H14BrClFNO2S and a molecular weight of 358.66 g/mol. Its IUPAC name is 4-bromo-N-(2-chloropentyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(2-chloropentyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116530073 |
| Molecular Formula | C11H14BrClFNO2S |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 4-bromo-N-(2-chloropentyl)-2-fluorobenzenesulfonamide |
| SMILES | CCCC(Cl)CNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H14BrClFNO2S/c1-2-3-9(13)7-15-18(16,17)11-5-4-8(12)6-10(11)14/h4-6,9,15H,2-3,7H2,1H3 |
| InChIKey | KDYQEPVWRXUVPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|