C11H14BrClFNO3S — CID 106245450
4-bromo-N-(3-chloro-4-methoxybutyl)-2-fluorobenzenesulfonamide (PubChem CID 106245450) has the molecular formula C11H14BrClFNO3S and a molecular weight of 374.66 g/mol. Its IUPAC name is 4-bromo-N-(3-chloro-4-methoxybutyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(3-chloro-4-methoxybutyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106245450 |
| Molecular Formula | C11H14BrClFNO3S |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 4-bromo-N-(3-chloro-4-methoxybutyl)-2-fluorobenzenesulfonamide |
| SMILES | COCC(Cl)CCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H14BrClFNO3S/c1-18-7-9(13)4-5-15-19(16,17)11-3-2-8(12)6-10(11)14/h2-3,6,9,15H,4-5,7H2,1H3 |
| InChIKey | YUFBDQNVFDEQQA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|