C12H17BrFNO3S — CID 104919371
4-bromo-2-fluoro-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide (PubChem CID 104919371) has the molecular formula C12H17BrFNO3S and a molecular weight of 354.24 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104919371 |
| Molecular Formula | C12H17BrFNO3S |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 4-bromo-2-fluoro-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide |
| SMILES | CC(CO)CCCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H17BrFNO3S/c1-9(8-16)3-2-6-15-19(17,18)12-5-4-10(13)7-11(12)14/h4-5,7,9,15-16H,2-3,6,8H2,1H3 |
| InChIKey | MDAYDVACEVZWRY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|