C12H17Br2NO3S — CID 103858962
2,5-dibromo-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide (PubChem CID 103858962) has the molecular formula C12H17Br2NO3S and a molecular weight of 415.15 g/mol. Its IUPAC name is 2,5-dibromo-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103858962 |
| Molecular Formula | C12H17Br2NO3S |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 2,5-dibromo-N-(5-hydroxy-4-methylpentyl)benzenesulfonamide |
| SMILES | CC(CO)CCCNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H17Br2NO3S/c1-9(8-16)3-2-6-15-19(17,18)12-7-10(13)4-5-11(12)14/h4-5,7,9,15-16H,2-3,6,8H2,1H3 |
| InChIKey | PUBAXQYSBLVKJW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|