C11H14Br3NO2S — CID 114295168
2,5-dibromo-N-(4-bromo-2-methylbutyl)benzenesulfonamide (PubChem CID 114295168) has the molecular formula C11H14Br3NO2S and a molecular weight of 464.02 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-bromo-2-methylbutyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(4-bromo-2-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114295168 |
| Molecular Formula | C11H14Br3NO2S |
| Molecular Weight | 464.02 g/mol |
| Exact Mass | 460.83 |
| IUPAC Name | 2,5-dibromo-N-(4-bromo-2-methylbutyl)benzenesulfonamide |
| SMILES | CC(CCBr)CNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H14Br3NO2S/c1-8(4-5-12)7-15-18(16,17)11-6-9(13)2-3-10(11)14/h2-3,6,8,15H,4-5,7H2,1H3 |
| InChIKey | BBHLASURZURLGX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|