C14H12Br4N2O4S2 — CID 100820102
2,5-dibromo-N-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]benzenesulfonamide (PubChem CID 100820102) has the molecular formula C14H12Br4N2O4S2 and a molecular weight of 656.01 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100820102 |
| Molecular Formula | C14H12Br4N2O4S2 |
| Molecular Weight | 656.01 g/mol |
| Exact Mass | 651.70 |
| IUPAC Name | 2,5-dibromo-N-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNS(=O)(=O)c1cc(Br)ccc1Br)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H12Br4N2O4S2/c15-9-1-3-11(17)13(7-9)25(21,22)19-5-6-20-26(23,24)14-8-10(16)2-4-12(14)18/h1-4,7-8,19-20H,5-6H2 |
| InChIKey | KGYJGXPCGKUIQF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.01 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|