C11H13Br2NO4S — CID 60643187
ethyl 3-[(2,5-dibromophenyl)sulfonylamino]propanoate (PubChem CID 60643187) has the molecular formula C11H13Br2NO4S and a molecular weight of 415.10 g/mol. Its IUPAC name is ethyl 3-[(2,5-dibromophenyl)sulfonylamino]propanoate.
| Compound Name | ethyl 3-[(2,5-dibromophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 60643187 |
| Molecular Formula | C11H13Br2NO4S |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | ethyl 3-[(2,5-dibromophenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)CCNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H13Br2NO4S/c1-2-18-11(15)5-6-14-19(16,17)10-7-8(12)3-4-9(10)13/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | GNCBWOCTOAUYBW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |