C11H15Br2N3O3S — CID 78953522
3-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 78953522) has the molecular formula C11H15Br2N3O3S and a molecular weight of 429.13 g/mol. Its IUPAC name is 3-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 78953522 |
| Molecular Formula | C11H15Br2N3O3S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 3-[2-[(2,5-dibromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H15Br2N3O3S/c1-16(2)11(17)14-5-6-15-20(18,19)10-7-8(12)3-4-9(10)13/h3-4,7,15H,5-6H2,1-2H3,(H,14,17) |
| InChIKey | PQHNZHGWQAWUDB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|