C11H17BrN4O3S — CID 83108301
3-[2-[(5-amino-2-bromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83108301) has the molecular formula C11H17BrN4O3S and a molecular weight of 365.25 g/mol. Its IUPAC name is 3-[2-[(5-amino-2-bromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(5-amino-2-bromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83108301 |
| Molecular Formula | C11H17BrN4O3S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 3-[2-[(5-amino-2-bromophenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C11H17BrN4O3S/c1-16(2)11(17)14-5-6-15-20(18,19)10-7-8(13)3-4-9(10)12/h3-4,7,15H,5-6,13H2,1-2H3,(H,14,17) |
| InChIKey | PHRBQZFQXATJPR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|