C13H22N4O3S — CID 83108138
3-[2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83108138) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83108138 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-[2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NCCNC(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H22N4O3S/c1-9-7-11(14)10(2)12(8-9)21(19,20)16-6-5-15-13(18)17(3)4/h7-8,16H,5-6,14H2,1-4H3,(H,15,18) |
| InChIKey | ICOAIFSKCOJWLG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|