C10H16BrN5O3S — CID 83114587
3-[2-[(2-amino-5-bromo-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83114587) has the molecular formula C10H16BrN5O3S and a molecular weight of 366.24 g/mol. Its IUPAC name is 3-[2-[(2-amino-5-bromo-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2-amino-5-bromo-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83114587 |
| Molecular Formula | C10H16BrN5O3S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-[2-[(2-amino-5-bromo-3-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C10H16BrN5O3S/c1-16(2)10(17)13-3-4-15-20(18,19)8-5-7(11)6-14-9(8)12/h5-6,15H,3-4H2,1-2H3,(H2,12,14)(H,13,17) |
| InChIKey | NTOMSUIKSCOESB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|