C11H19BrN4O2S — CID 22515875
2-amino-5-bromo-N-[2-(diethylamino)ethyl]pyridine-3-sulfonamide (PubChem CID 22515875) has the molecular formula C11H19BrN4O2S and a molecular weight of 351.27 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[2-(diethylamino)ethyl]pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-[2-(diethylamino)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 22515875 |
| Molecular Formula | C11H19BrN4O2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-amino-5-bromo-N-[2-(diethylamino)ethyl]pyridine-3-sulfonamide |
| SMILES | CCN(CC)CCNS(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C11H19BrN4O2S/c1-3-16(4-2)6-5-15-19(17,18)10-7-9(12)8-14-11(10)13/h7-8,15H,3-6H2,1-2H3,(H2,13,14) |
| InChIKey | ATNZPORVSYOOAX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |