C10H17N5O3S — CID 83115602
3-[2-[(2-amino-4-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83115602) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is 3-[2-[(2-amino-4-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2-amino-4-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83115602 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-[2-[(2-amino-4-pyridinyl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)c1ccnc(N)c1 |
| InChI | InChI=1S/C10H17N5O3S/c1-15(2)10(16)13-5-6-14-19(17,18)8-3-4-12-9(11)7-8/h3-4,7,14H,5-6H2,1-2H3,(H2,11,12)(H,13,16) |
| InChIKey | BRSDKXVKSJTWTB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|