C12H18N4O5S — CID 118986455
1,1-dimethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea (PubChem CID 118986455) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 118986455 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O5S/c1-9-4-5-10(8-11(9)16(18)19)22(20,21)14-7-6-13-12(17)15(2)3/h4-5,8,14H,6-7H2,1-3H3,(H,13,17) |
| InChIKey | JCCGJLVSQGDNQR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|