C11H16N2O5S — CID 64910826
N-(3-hydroxybutyl)-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 64910826) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(3-hydroxybutyl)-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 64910826 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(3-hydroxybutyl)-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(C)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O5S/c1-8-3-4-10(7-11(8)13(15)16)19(17,18)12-6-5-9(2)14/h3-4,7,9,12,14H,5-6H2,1-2H3 |
| InChIKey | QCSLCASVANBTRW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|