C10H10N2O4S — CID 9356117
4-methyl-3-nitro-N-prop-2-ynylbenzenesulfonamide (PubChem CID 9356117) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 4-methyl-3-nitro-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 9356117 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4-methyl-3-nitro-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N2O4S/c1-3-6-11-17(15,16)9-5-4-8(2)10(7-9)12(13)14/h1,4-5,7,11H,6H2,2H3 |
| InChIKey | SANCFGAHTAYLBQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|