C11H18ClN3O4S — CID 119988333
N-(2-amino-2-methylpropyl)-4-methyl-3-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119988333) has the molecular formula C11H18ClN3O4S and a molecular weight of 323.80 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-4-methyl-3-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-4-methyl-3-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119988333 |
| Molecular Formula | C11H18ClN3O4S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-4-methyl-3-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)(C)N)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C11H17N3O4S.ClH/c1-8-4-5-9(6-10(8)14(15)16)19(17,18)13-7-11(2,3)12;/h4-6,13H,7,12H2,1-3H3;1H |
| InChIKey | ILRPUEYLGSQTLI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|