C18H23N3O6S2 — CID 17052312
2,4,6-trimethyl-N-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]benzenesulfonamide (PubChem CID 17052312) has the molecular formula C18H23N3O6S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17052312 |
| Molecular Formula | C18H23N3O6S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2,4,6-trimethyl-N-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C18H23N3O6S2/c1-12-9-14(3)18(15(4)10-12)29(26,27)20-8-7-19-28(24,25)16-6-5-13(2)17(11-16)21(22)23/h5-6,9-11,19-20H,7-8H2,1-4H3 |
| InChIKey | GYHAQHWFWBAPFM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|