C12H18N4O5S — CID 4039653
1-ethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea (PubChem CID 4039653) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea.
| Compound Name | 1-ethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 4039653 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-ethyl-3-[2-[(4-methyl-3-nitrophenyl)sulfonylamino]ethyl]urea |
| SMILES | CCNC(=O)NCCNS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H18N4O5S/c1-3-13-12(17)14-6-7-15-22(20,21)10-5-4-9(2)11(8-10)16(18)19/h4-5,8,15H,3,6-7H2,1-2H3,(H2,13,14,17) |
| InChIKey | IXZRTRHBTLTWQK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|