C10H13N3O6S — CID 43398029
N-[2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]ethyl]acetamide (PubChem CID 43398029) has the molecular formula C10H13N3O6S and a molecular weight of 303.30 g/mol. Its IUPAC name is N-[2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 43398029 |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-[2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13N3O6S/c1-7(14)11-4-5-12-20(18,19)8-2-3-10(15)9(6-8)13(16)17/h2-3,6,12,15H,4-5H2,1H3,(H,11,14) |
| InChIKey | DYIDEACAJLEXLG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|