C11H15N3O6S — CID 43400349
2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-propan-2-ylacetamide (PubChem CID 43400349) has the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 43400349 |
| Molecular Formula | C11H15N3O6S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15N3O6S/c1-7(2)13-11(16)6-12-21(19,20)8-3-4-10(15)9(5-8)14(17)18/h3-5,7,12,15H,6H2,1-2H3,(H,13,16) |
| InChIKey | XVGUXTYKRDIPOH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|