C10H14N4O5S — CID 60630712
N-methyl-2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetamide (PubChem CID 60630712) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is N-methyl-2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetamide.
| Compound Name | N-methyl-2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 60630712 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-methyl-2-[[4-(methylamino)-3-nitrophenyl]sulfonylamino]acetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1ccc(NC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N4O5S/c1-11-8-4-3-7(5-9(8)14(16)17)20(18,19)13-6-10(15)12-2/h3-5,11,13H,6H2,1-2H3,(H,12,15) |
| InChIKey | WQQYPAPZZUEPIN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|