C9H10F3N3O4S — CID 62148898
4-(methylamino)-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 62148898) has the molecular formula C9H10F3N3O4S and a molecular weight of 313.26 g/mol. Its IUPAC name is 4-(methylamino)-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-(methylamino)-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62148898 |
| Molecular Formula | C9H10F3N3O4S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 4-(methylamino)-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)NCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10F3N3O4S/c1-13-7-3-2-6(4-8(7)15(16)17)20(18,19)14-5-9(10,11)12/h2-4,13-14H,5H2,1H3 |
| InChIKey | WTPHJXGXVGIULV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|