C12H20N4O4S — CID 62640031
N-[2-[ethyl(methyl)amino]ethyl]-4-(methylamino)-3-nitrobenzenesulfonamide (PubChem CID 62640031) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]ethyl]-4-(methylamino)-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[ethyl(methyl)amino]ethyl]-4-(methylamino)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62640031 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]ethyl]-4-(methylamino)-3-nitrobenzenesulfonamide |
| SMILES | CCN(C)CCNS(=O)(=O)c1ccc(NC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H20N4O4S/c1-4-15(3)8-7-14-21(19,20)10-5-6-11(13-2)12(9-10)16(17)18/h5-6,9,13-14H,4,7-8H2,1-3H3 |
| InChIKey | OCVNBMWJYGOWNI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|