C8H6F4N2O4S — CID 90101695
4-fluoro-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 90101695) has the molecular formula C8H6F4N2O4S and a molecular weight of 302.21 g/mol. Its IUPAC name is 4-fluoro-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90101695 |
| Molecular Formula | C8H6F4N2O4S |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 4-fluoro-3-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCC(F)(F)F)ccc1F |
| InChI | InChI=1S/C8H6F4N2O4S/c9-6-2-1-5(3-7(6)14(15)16)19(17,18)13-4-8(10,11)12/h1-3,13H,4H2 |
| InChIKey | CFLQZYPPMDQLDX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|