C9H8FN5O4S — CID 60983705
4-fluoro-3-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide (PubChem CID 60983705) has the molecular formula C9H8FN5O4S and a molecular weight of 301.26 g/mol. Its IUPAC name is 4-fluoro-3-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-3-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60983705 |
| Molecular Formula | C9H8FN5O4S |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-fluoro-3-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCc2ncn[nH]2)ccc1F |
| InChI | InChI=1S/C9H8FN5O4S/c10-7-2-1-6(3-8(7)15(16)17)20(18,19)13-4-9-11-5-12-14-9/h1-3,5,13H,4H2,(H,11,12,14) |
| InChIKey | LYWJYXLNGGCMFZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|