C8H6FN5O4S — CID 82854963
3-fluoro-4-nitro-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide (PubChem CID 82854963) has the molecular formula C8H6FN5O4S and a molecular weight of 287.23 g/mol. Its IUPAC name is 3-fluoro-4-nitro-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-4-nitro-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 82854963 |
| Molecular Formula | C8H6FN5O4S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-fluoro-4-nitro-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2ncn[nH]2)cc1F |
| InChI | InChI=1S/C8H6FN5O4S/c9-6-3-5(1-2-7(6)14(15)16)19(17,18)13-8-10-4-11-12-8/h1-4H,(H2,10,11,12,13) |
| InChIKey | QBDPFQAGCUZCAP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|