C9H8FN5O4S — CID 82843001
3-fluoro-N-(2-methyl-1,2,4-triazol-3-yl)-4-nitrobenzenesulfonamide (PubChem CID 82843001) has the molecular formula C9H8FN5O4S and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-fluoro-N-(2-methyl-1,2,4-triazol-3-yl)-4-nitrobenzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-methyl-1,2,4-triazol-3-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 82843001 |
| Molecular Formula | C9H8FN5O4S |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-fluoro-N-(2-methyl-1,2,4-triazol-3-yl)-4-nitrobenzenesulfonamide |
| SMILES | Cn1ncnc1NS(=O)(=O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C9H8FN5O4S/c1-14-9(11-5-12-14)13-20(18,19)6-2-3-8(15(16)17)7(10)4-6/h2-5H,1H3,(H,11,12,13) |
| InChIKey | FTTVBRGMCWRBKY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|