C9H9N5O5S — CID 80708724
4-hydroxy-N-(2-methyl-1,2,4-triazol-3-yl)-3-nitrobenzenesulfonamide (PubChem CID 80708724) has the molecular formula C9H9N5O5S and a molecular weight of 299.27 g/mol. Its IUPAC name is 4-hydroxy-N-(2-methyl-1,2,4-triazol-3-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(2-methyl-1,2,4-triazol-3-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 80708724 |
| Molecular Formula | C9H9N5O5S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-hydroxy-N-(2-methyl-1,2,4-triazol-3-yl)-3-nitrobenzenesulfonamide |
| SMILES | Cn1ncnc1NS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9N5O5S/c1-13-9(10-5-11-13)12-20(18,19)6-2-3-8(15)7(4-6)14(16)17/h2-5,15H,1H3,(H,10,11,12) |
| InChIKey | UQCFMOIWSXEJCZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|