C14H14N2O5S — CID 31579190
N-(2,6-dimethylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide (PubChem CID 31579190) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 31579190 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-hydroxy-3-nitrobenzenesulfonamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14N2O5S/c1-9-4-3-5-10(2)14(9)15-22(20,21)11-6-7-13(17)12(8-11)16(18)19/h3-8,15,17H,1-2H3 |
| InChIKey | JXTCXNUQJCXHLP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|