C13H10N2O7S — CID 3768669
2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoic acid (PubChem CID 3768669) has the molecular formula C13H10N2O7S and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 3768669 |
| Molecular Formula | C13H10N2O7S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N2O7S/c16-12-6-5-8(7-11(12)15(19)20)23(21,22)14-10-4-2-1-3-9(10)13(17)18/h1-7,14,16H,(H,17,18) |
| InChIKey | KJEWEPKDQIOROF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|