C25H20N4O7S — CID 4854177
2-[[4-[2-[1-(1-hydroxynaphthalen-2-yl)ethylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 4854177) has the molecular formula C25H20N4O7S and a molecular weight of 520.52 g/mol. Its IUPAC name is 2-[[4-[2-[1-(1-hydroxynaphthalen-2-yl)ethylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[2-[1-(1-hydroxynaphthalen-2-yl)ethylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 4854177 |
| Molecular Formula | C25H20N4O7S |
| Molecular Weight | 520.52 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[[4-[2-[1-(1-hydroxynaphthalen-2-yl)ethylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | CC(=NNc1ccc(S(=O)(=O)Nc2ccccc2C(=O)O)cc1[N+](=O)[O-])c1ccc2ccccc2c1O |
| InChI | InChI=1S/C25H20N4O7S/c1-15(18-12-10-16-6-2-3-7-19(16)24(18)30)26-27-22-13-11-17(14-23(22)29(33)34)37(35,36)28-21-9-5-4-8-20(21)25(31)32/h2-14,27-28,30H,1H3,(H,31,32) |
| InChIKey | SADPVNASTWVQCW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 171.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|